| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5,7-Dihydroxy-4-methylcoumarin Basic information |
| Product Name: | 5,7-Dihydroxy-4-methylcoumarin | | Synonyms: | 5,7-Dihydroxy-4-methylcoumarin ,98%;5,7-Dihydroxy-4-methyl-2H-1-benzopyran-2-one;5,7-Dihydroxy-4-methyl-2-chromenone;Coumarin, 5,7-dihydroxy-4-methyl-;DIHYDROXY-4-METHYLCOUMARIN, 5,7-;DIHYDROXY-4-METHYLCOUMARIN, 5,7-(RG);4-METHYL-5,7-DIHYDROXYCOUMARIN;5,7-DIHYDROXY-4-METHYL-2H-CHROMEN-2-ONE | | CAS: | 2107-76-8 | | MF: | C10H8O4 | | MW: | 192.17 | | EINECS: | 218-289-9 | | Product Categories: | Building Blocks;Chemical Synthesis;Coumarins;Building Blocks;Heterocyclic Building Blocks;Heterocyclic Building Blocks | | Mol File: | 2107-76-8.mol |  |
| | 5,7-Dihydroxy-4-methylcoumarin Chemical Properties |
| Melting point | 296-299 °C (lit.) | | Boiling point | 472.1±14.0 °C(Predicted) | | density | 1.456±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 7.29±0.20(Predicted) | | form | Solid | | color | Off-White to Pale Green | | Sensitive | Light Sensitive | | λmax | 322nm(MeOH)(lit.) | | BRN | 179133 | | InChI | 1S/C10H8O4/c1-5-2-9(13)14-8-4-6(11)3-7(12)10(5)8/h2-4,11-12H,1H3 | | InChIKey | QNVWGEJMXOQQPM-UHFFFAOYSA-N | | SMILES | CC1=CC(=O)Oc2cc(O)cc(O)c12 | | CAS DataBase Reference | 2107-76-8(CAS DataBase Reference) | | EPA Substance Registry System | 5,7-Dihydroxy-4-methylcoumarin (2107-76-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Hazardous Substances Data | 2107-76-8(Hazardous Substances Data) |
| | 5,7-Dihydroxy-4-methylcoumarin Usage And Synthesis |
| Chemical Properties | White metallic powder | | Uses | 5,7-Dihydroxy-4-methylcoumarin may be used in the synthesis of pyrano[2,3-h]coumarin derivatives and 5,7-dihydroxy-8-formyl-4-methylcoumarin. | | Definition | ChEBI: 5,7-Dihydroxy-4-methylcoumarin is a hydroxycoumarin. | | General Description | Yellow powder. Fluoresces blue. Absorbs ultraviolet light. | | Air & Water Reactions | Slightly water soluble . | | Reactivity Profile | 5,7-Dihydroxy-4-methylcoumarin is a phenol and lactone. Phenols do not behave as organic alcohols, as one might guess from the presence of a hydroxyl (-OH) group in their structure. Instead, they react as weak organic acids. Phenols and cresols are much weaker as acids than common carboxylic acids (phenol has Ka = 1.3 x 10^[-10]). These materials are incompatible with strong reducing substances such as hydrides, nitrides, alkali metals, and sulfides. Flammable gas (H2) is often generated, and the heat of the reaction may ignite the gas. Heat is also generated by the acid-base reaction between phenols and bases. Such heating may initiate polymerization of the organic compound. Phenols are sulfonated very readily (for example, by concentrated sulfuric acid at room temperature). The reactions generate heat. Phenols are also nitrated very rapidly, even by dilute nitric acid. Lactones react similarly to esters. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. | | Fire Hazard | Flash point data for 5,7-Dihydroxy-4-methylcoumarin are not available. 5,7-Dihydroxy-4-methylcoumarin is probably combustible. |
| | 5,7-Dihydroxy-4-methylcoumarin Preparation Products And Raw materials |
|