| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:SodiuM 2-propanethiolate
CAS:20607-43-6
Purity:technical, >=90.0% (RT) Package:10G
|
|
| | SODIUM 2-PROPANETHIOLATE Basic information |
| Product Name: | SODIUM 2-PROPANETHIOLATE | | Synonyms: | SODIUM 2-PROPANETHIOLATE;2-PROPANETHIOL SODIUM SALT;2-Propanethiol, sodium salt (8CI,9CI);SodiuM 2-propanethiolate technical, >=90.0% (RT);Isopropyl mercaptan sodium salt | | CAS: | 20607-43-6 | | MF: | C3H9NaS | | MW: | 100.15 | | EINECS: | | | Product Categories: | | | Mol File: | 20607-43-6.mol |  |
| | SODIUM 2-PROPANETHIOLATE Chemical Properties |
| form | powder | | BRN | 3618618 | | InChI | InChI=1S/C3H8S.Na.H/c1-3(2)4;;/h3-4H,1-2H3;; | | InChIKey | FGVUSPBQALXVSY-UHFFFAOYSA-N | | SMILES | C(S)(C)C.[NaH] |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3263 8/PG 3 | | WGK Germany | 3 | | F | 1-10-13 | | HazardClass | 4.3 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | SODIUM 2-PROPANETHIOLATE Usage And Synthesis |
| Uses | - Biphenyl and bimesityl tetrasulfonic acid–new linker molecules for coordination polymers: This study discusses the use of Sodium 2-propanethiolate in the synthesis of new coordination polymers. The article details the process and the resulting chemical structures, providing insights into the potential applications of these materials in various fields (F Behler, MS Wickleder, J Christoffers - ARKIVOC, 2015).
|
| | SODIUM 2-PROPANETHIOLATE Preparation Products And Raw materials |
|