| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (E)-2-Nitroethenylbenzene Basic information |
| Product Name: | (E)-2-Nitroethenylbenzene | | Synonyms: | TRANS-1-NITRO-2-PHENYLETHYLENE;trans-3-Nitrostyrene;TRANS-BETA-NITROSTYRENE;(e)-beta-nitrostyrene;(e)-styren;Benzene, (2-nitroethenyl)-, (E)-;(E)-1-(2-nitrovinyl)benzene;trans-beta-Nitrostyrene 99% | | CAS: | 5153-67-3 | | MF: | C8H7NO2 | | MW: | 149.15 | | EINECS: | 629-597-1 | | Product Categories: | Ethanes/ethenes | | Mol File: | 5153-67-3.mol |  |
| | (E)-2-Nitroethenylbenzene Chemical Properties |
| Melting point | 55-58 °C(lit.) | | Boiling point | 250-260 °C(lit.) | | density | 1.2517 (rough estimate) | | refractive index | 1.5320 (estimate) | | Fp | 250-260°C | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | Crystals | | color | Yellow | | Water Solubility | Insoluble in water. | | λmax | 320nm(lit.) | | BRN | 1210066 | | InChI | 1S/C8H7NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+ | | InChIKey | PIAOLBVUVDXHHL-VOTSOKGWSA-N | | SMILES | [O-][N+](=O)\C=C\c1ccccc1 | | NIST Chemistry Reference | Styrene, «beta»-nitro-, (E)-(5153-67-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | WL5460000 | | TSCA | Yes | | HS Code | 29042090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (E)-2-Nitroethenylbenzene Usage And Synthesis |
| Chemical Properties | Yellow crystals | | Uses | trans-β-Nitrostyrene, and its derivatives such as 3,4-methylenedioxy-β-nitrostyrene (MNS) and 4-O-benzoyl-3-methoxy-β-nitrostyrene (BMNS), has shown to exhibit potent anti-platelet activities and cytotoxicity. | | Purification Methods | Crystallise the styrene from absolute EtOH, or three times from *benzene/pet ether (b 60-80o) (1:1). [Beilstein 5 III 1180, 5 IV 1352.] |
| | (E)-2-Nitroethenylbenzene Preparation Products And Raw materials |
|