|
|
| | 2-[4-(2,3-DIHYDROXYPROPOXY)PHENYL]ACETAMIDE Basic information |
| | 2-[4-(2,3-DIHYDROXYPROPOXY)PHENYL]ACETAMIDE Chemical Properties |
| Melting point | 183-185°C | | Boiling point | 523.7±45.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 13.52±0.20(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecules) | | InChI | InChI=1S/C11H15NO4/c12-11(15)5-8-1-3-10(4-2-8)16-7-9(14)6-13/h1-4,9,13-14H,5-7H2,(H2,12,15) | | InChIKey | CQOQCZLTCMUVMX-UHFFFAOYSA-N | | SMILES | C1(CC(N)=O)=CC=C(OCC(O)CO)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-[4-(2,3-DIHYDROXYPROPOXY)PHENYL]ACETAMIDE Usage And Synthesis |
| Uses | Des(isopropylamino) Atenolol Diol (Atenolol EP Impurity B; Atenolol Impurity B; Atenolol USP Related Compound A) is an Atenolol (A790075) impurity in bulk and in tablets. |
| | 2-[4-(2,3-DIHYDROXYPROPOXY)PHENYL]ACETAMIDE Preparation Products And Raw materials |
|