- S-Carboxymethyl-L-cysteine
-
- $0.00 / 25Kg/Drum
-
2026-04-30
- CAS:2387-59-9
- Min. Order: 1KG
- Purity: 98.5%-101.0%; EP
- Supply Ability: 10 tons
|
| | S-Carboxymethyl-L-cysteine Basic information |
| Product Name: | S-Carboxymethyl-L-cysteine | | Synonyms: | mucodyne;2-amino-3-(carboxymethylthio)propionic acid;2-azanyl-3-(carboxymethylsulfanyl)propanoic acid;Broncodeterge;S-Carboxymethyl-L-cysteine USP/EP/BP;carbocistein;Glycolate si temple;S-Carbomethuloysteine | | CAS: | 2387-59-9 | | MF: | C5H9NO4S | | MW: | 179.19 | | EINECS: | 246-934-4 | | Product Categories: | | | Mol File: | 2387-59-9.mol |  |
| | S-Carboxymethyl-L-cysteine Chemical Properties |
| Melting point | 205.5°C | | density | 1.315 (estimate) | | refractive index | 1.5216 (estimate) | | form | solid | | InChI | InChI=1/C5H9NO4S/c6-3(5(9)10)1-11-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/s3 | | InChIKey | GBFLZEXEOZUWRN-ZJPLZJKBNA-N | | SMILES | C(O)(=O)[C@H](CSCC(O)=O)N |&1:3,r| |
| | S-Carboxymethyl-L-cysteine Usage And Synthesis |
| Uses | Mucolytic. | | Brand name | Loviscol
(Wyeth-Ayerst); Mucofan (Wyeth-Ayerst). |
| | S-Carboxymethyl-L-cysteine Preparation Products And Raw materials |
|