- MELLITIC ACID
-
- $0.00 / 1kg
-
2025-04-04
- CAS:517-60-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
- MELLITIC ACID
-
- $1.00 / 1g
-
2020-01-10
- CAS:517-60-2
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | MELLITIC ACID Basic information |
| Product Name: | MELLITIC ACID | | Synonyms: | MELLITIC ACID 96+%;1,2,3,4,5,6-Benzenehexacarboxylic acid;Hexacarboxybenzene;Mellic acid;benzenehexacarbonic acid;Benzene-1,2,3,4,5,6-hexacarboxylic acid;Mellitic acid,99%;Mellitic acid,Benzenehexacarboxylic acid | | CAS: | 517-60-2 | | MF: | C12H6O12 | | MW: | 342.17 | | EINECS: | 208-243-6 | | Product Categories: | C11 to C12;Carbonyl Compounds;Building Blocks;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks | | Mol File: | 517-60-2.mol |  |
| | MELLITIC ACID Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 437.66°C (rough estimate) | | density | 1.8324 (rough estimate) | | refractive index | 1.7610 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Completely soluble in water | | form | powder to crystal | | pka | pK1: 0.68;pK2: 2.21;pK3: 3.52;pK4: 5.09;pK5: 6.32; pK6: 7.49 (25°C) | | color | White to Light yellow | | Merck | 14,5825 | | BRN | 2228443 | | InChI | 1S/C12H6O12/c13-7(14)1-2(8(15)16)4(10(19)20)6(12(23)24)5(11(21)22)3(1)9(17)18/h(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24) | | InChIKey | YDSWCNNOKPMOTP-UHFFFAOYSA-N | | SMILES | OC(=O)c1c(C(O)=O)c(C(O)=O)c(C(O)=O)c(C(O)=O)c1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | MELLITIC ACID Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | Mellitic acid is part of a group of benzenepolycarboxylic acids that have potential anti-hemorrhagic properties. Mellitic acid is also used as a motif to investigate possible radial self-assembly using complementary aromatic bases. | | Definition | ChEBI: A benzene-derived hexacarboxylic acid in which each carbon of benzene carries a carboxy substituent. |
| | MELLITIC ACID Preparation Products And Raw materials |
|