|
|
| | 2-Chloro-5-trifluoromethylpyridine Basic information | | Synthesis |
| | 2-Chloro-5-trifluoromethylpyridine Chemical Properties |
| Melting point | 32-34 °C(lit.) | | Boiling point | 152 °C | | density | 1.417 g/mL at 25 °C(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | -2.57±0.10(Predicted) | | form | Crystalline Low Melting Solid | | Specific Gravity | 1.417 | | color | White to yellow | | BRN | 3649688 | | InChI | InChI=1S/C6H3ClF3N/c7-5-2-1-4(3-11-5)6(8,9)10/h1-3H | | InChIKey | JFZJMSDDOOAOIV-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 52334-81-3(CAS DataBase Reference) | | EPA Substance Registry System | Pyridine, 2-chloro-5-(trifluoromethyl)- (52334-81-3) |
| Hazard Codes | Xi,Xn,T,F | | Risk Statements | 36/37/38-20/21/22-25-11 | | Safety Statements | 26-37/39-36/37/39-45-22-16 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | US7530000 | | Hazard Note | Irritant | | TSCA | T | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-5-trifluoromethylpyridine Usage And Synthesis |
| Synthesis | 2-Chloro-5-trifluoromethylpyridine can be synthesized by fluorination of 2-chloro-5-trichloromethylpyridine. | | Chemical Properties | white to yellowish crystalline low melting solid | | Uses | 2-Chloro-5-(trifluoromethyl)pyridine may be employed as model substrate to investigate the regioexhaustive functionalization. | | General Description | 2-Chloro-5-(trifluoromethyl)pyridine is a chloro(trifluoromethyl) pyridine. |
| | 2-Chloro-5-trifluoromethylpyridine Preparation Products And Raw materials |
|