- L-Tryptophanol
-
- $0.00 / 25KG
-
2025-12-17
- CAS:2899-29-8
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
- L-Tryptophanol
-
- $20.00 / 1KG
-
2019-07-06
- CAS:2899-29-8
- Min. Order: 10KG
- Purity: 10
- Supply Ability: 100kg
|
| | L-Tryptophanol Basic information |
| | L-Tryptophanol Chemical Properties |
| Melting point | 73-77 °C (lit.) | | Boiling point | 444.2±30.0 °C(Predicted) | | alpha | -20.5 º (c=1, MeOH) | | density | 1.245±0.06 g/cm3(Predicted) | | refractive index | -21 ° (C=1, MeOH) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 12.85±0.10(Predicted) | | form | Viscous Liquid | | color | Brown | | Optical Rotation | [α]20/D 20.5°, c = 1 in methanol | | Water Solubility | Soluble in water 11.4 g/L (25°C). | | Major Application | peptide synthesis | | InChI | 1S/C11H14N2O/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6,9,13-14H,5,7,12H2/t9-/m0/s1 | | InChIKey | UDQCRUSSQAXPJY-VIFPVBQESA-N | | SMILES | N[C@H](CO)Cc1c[nH]c2ccccc12 | | CAS DataBase Reference | 2899-29-8(CAS DataBase Reference) |
| | L-Tryptophanol Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses | L-Tryptophanol is an amino acid used in the construction of peptides and proteins. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Tryptophanol Preparation Products And Raw materials |
|