|
|
| | Manganic acetylacetonate Basic information |
| | Manganic acetylacetonate Chemical Properties |
| Melting point | 159-161 °C (dec.)(lit.) | | storage temp. | Store at room temperature | | solubility | Soluble in benzene, ethyl acetate | | form | Crystalline Powder | | color | Black | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Hygroscopic | | Exposure limits | OSHA: Ceiling 5 mg/m3
NIOSH: IDLH 500 mg/m3; TWA 1 mg/m3; STEL 3 mg/m3 | | Stability: | hygroscopic | | InChI | 1S/3C5H8O2.Mn/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; | | InChIKey | HYZQBNDRDQEWAN-LNTINUHCSA-K | | SMILES | CC(=O)\C=C(\C)O[Mn](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O | | NIST Chemistry Reference | Manganic acetylacetonate(14284-89-0) | | EPA Substance Registry System | Manganese, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (14284-89-0) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 36/37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29141900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Manganic acetylacetonate Usage And Synthesis |
| Chemical Properties | black crystalline powder | | Uses | It is mainly used as a solvent in paint and a precursor to vitamin E. | | General Description | Manganese(III) Acetylacetonate is a one-electron oxidant used to oxidize phenols, β-dicarbonyl compounds, and thiols to the corresponding
radical. | | reaction suitability | core: manganese
reagent type: catalyst | | Solubility in organics |
Manganic acetylacetonate is slightly soluble in water; soluble in acetone, benzene, chloroform, ether, ethanol, ethyl acetate.
|
| | Manganic acetylacetonate Preparation Products And Raw materials |
|