|
|
| | MAGNESIUM METHYL CARBONATE Basic information |
| Product Name: | MAGNESIUM METHYL CARBONATE | | Synonyms: | METHOXYMAGNESIUM METHYL CARBONATE;MAGNESIUM METHYL CARBONATE;METHYL METHOXYMAGNESIUM CARBONATE;methoxy(methylcarbonato-o)-magnesiu;STILES REAGENT;STILE'S REAGENT;STILES' REAGENT;MMC | | CAS: | 4861-79-4 | | MF: | C3H6MgO4 | | MW: | 130.38 | | EINECS: | 225-466-4 | | Product Categories: | | | Mol File: | 4861-79-4.mol |  |
| | MAGNESIUM METHYL CARBONATE Chemical Properties |
| density | 1.103 g/mL at 25 °C | | Fp | 52 °F | | solubility | soluble in DMSO, Methanol | | form | Clear Colourless Solution | | Specific Gravity | 1.103 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 4342967 | | InChI | InChI=1S/C2H4O3.CH3O.Mg/c1-5-2(3)4;1-2;/h1H3,(H,3,4);1H3;/q;-1;+2/p-1 | | InChIKey | PNVKCUSCADAAMP-UHFFFAOYSA-M | | SMILES | C(=O)(OC)O[Mg]OC | | EPA Substance Registry System | Magnesium, methoxy(monomethyl carbonato-.kappa.O')- (4861-79-4) |
| | MAGNESIUM METHYL CARBONATE Usage And Synthesis |
| Chemical Properties | clear slightly yellow solution | | Uses | Magnesium Methyl Carbonate Solution (2.0 M in DMF) is used to prepare synthetic oleanane and ursane triterpenoids as active inhibitors of nitric oxide production in mouse macrophages. | | Reactivity Profile | Magnesium methyl carbonate is an agent for the α-carboxylation of nitroalkanes, ketones, lactones, hydantoins, and phenols.
| | Synthesis | Magnesium methyl carbonate could be prepared in situ by saturating a solution (2 M) of Magnesium Methoxide in DMF with Carbon Dioxide. It is assumed to have the formula MeOMgOCO2Me.(CO2)n where n varies with temperature and solvent.
|
| | MAGNESIUM METHYL CARBONATE Preparation Products And Raw materials |
|