|
|
| | 4-Acetylbenzenesulfonyl chloride Basic information |
| | 4-Acetylbenzenesulfonyl chloride Chemical Properties |
| Melting point | 84-87 °C | | Boiling point | 338.6±25.0 °C(Predicted) | | density | 1.3949 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly) | | form | Powder and/or Chunks | | color | White to orange to brown | | Water Solubility | Soluble in water (201.8 mg/L) 25°C. | | Sensitive | Moisture Sensitive | | BRN | 2099148 | | InChI | 1S/C8H7ClO3S/c1-6(10)7-2-4-8(5-3-7)13(9,11)12/h2-5H,1H3 | | InChIKey | FXVDNCRTKXMSEZ-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(cc1)S(Cl)(=O)=O | | CAS DataBase Reference | 1788-10-9(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37/38 | | Safety Statements | 26-36/37/39-45-25-36 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | F | 10-21 | | TSCA | No | | HazardClass | CORROSIVE | | HazardClass | 8 | | HS Code | 29147000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Acetylbenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | brown crystalline powder | | Uses | 4-Acetylbenzenesulfonyl chloride is used as a sulfanilamide drug intermediary |
| | 4-Acetylbenzenesulfonyl chloride Preparation Products And Raw materials |
|