Diacetone L-sorbose manufacturers
- Diacetone L-sorbose
-
- $1.00
-
2019-12-31
- CAS:17682-70-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Diacetone L-sorbose Basic information |
| | Diacetone L-sorbose Chemical Properties |
| Melting point | 55-65°C | | Boiling point | 130-135 °C(Press: 0.1-0.3 Torr) | | density | 1.181±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetone, Dichloromethane | | pka | 14.66±0.10(Predicted) | | form | Powder | | color | White to Off-white | | Optical Rotation | [α]/D -16.5±1.5°, c = 1.5 in acetone | | InChI | 1S/C12H20O6/c1-10(2)14-5-7-8(16-10)9-12(6-13,15-7)18-11(3,4)17-9/h7-9,13H,5-6H2,1-4H3/t7-,8+,9-,12-/m0/s1 | | InChIKey | GQXSDDHYUVYJCQ-NHRVJRKFSA-N | | SMILES | CC1(C)OC[C@@H]2O[C@@]3(CO)OC(C)(C)O[C@H]3[C@@H]2O1 | | CAS DataBase Reference | 17682-70-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | Diacetone L-sorbose Usage And Synthesis |
| Chemical Properties | White Crytalline Solid | | Uses | 2,3:4,6-Di-O-isopropylidene-α-L-sorbofuranose (cas# 17682-70-1) is a compound useful in organic synthesis. |
| | Diacetone L-sorbose Preparation Products And Raw materials |
|