|
|
| | Cbz-beta-Amino-L-alanine Basic information |
| Product Name: | Cbz-beta-Amino-L-alanine | | Synonyms: | L-ALANINE, 3-AMINO-N-[(PHENYLMETHOXY)CARBONYL]-;Z-Dap-OH >=98.0% (NT);Nα-Z-L-2,3-diaminopropionic acid≥ 98% (Assay);CBZ-BETA-AMINO-L-ALANINE;CBZ-L-B-AMINOALANINE;CBZ-L-DAP-OH;3-AMINO-2-BENZYLOXYCARBONYLAMINO-PROPIONIC ACID;Z-L-2,3-DIAMINOPROPIONIC ACID | | CAS: | 35761-26-3 | | MF: | C11H14N2O4 | | MW: | 238.24 | | EINECS: | 1533716-785-6 | | Product Categories: | Aromatics;Amino Acids & Derivatives | | Mol File: | 35761-26-3.mol |  |
| | Cbz-beta-Amino-L-alanine Chemical Properties |
| Melting point | ~240 °C (dec.) | | Boiling point | 463.8±45.0 °C(Predicted) | | alpha | -39 º (1%, 1N HCl) | | density | 1.303±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in dilute acid. | | pka | 2.86±0.16(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]20/D 39±1°, c = 1% in 1 M HCl | | Sensitive | Hygroscopic | | BRN | 4486950 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H14N2O4/c12-6-9(10(14)15)13-11(16)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15)/t9-/m0/s1 | | InChIKey | FOXRXVSTFGNURG-VIFPVBQESA-N | | SMILES | C(O)(=O)[C@H](CN)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 35761-26-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3 | | HS Code | 2922.49.3700 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Cbz-beta-Amino-L-alanine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Nalpha-Benzyloxycarbonyl-L-2,3-diaminopropionic acid is a important building block for the synthesis of peptides containing DAP residues, e.g. bleomycins, edeines, tuberactinomycins. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | The general procedure for the synthesis of N(alpha)-Z-L-2,3-diaminopropionic acid from (S)-2-(((benzyloxy)carbonyl)amino)-3-((tert-butoxycarbonyl)amino)propionic acid is as follows: 50 g of (S)-N-benzyloxycarbonyl-N'-tert-butoxycarbonyl-2,3-diaminopropionic acid was dissolved in 500 mL of methylene chloride, followed by 50 mL of trifluoroacetic acid. The reaction mixture was stirred at 50 °C for the reaction and subsequently left at room temperature overnight. Upon completion of the reaction, the reaction mixture was concentrated to dryness by rotary evaporator and the evaporation process was repeated to completely remove the solvent. | | References | [1] Collection of Czechoslovak Chemical Communications, 1976, vol. 41, p. 2969 - 2977 [2] Patent: CN108452321, 2018, A. Location in patent: Paragraph 0113; 0114; 0115; 0116 |
| | Cbz-beta-Amino-L-alanine Preparation Products And Raw materials |
|