- EDDS
-
- $100.00
-
2026-10-10
- CAS:20846-91-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000 KG
|
| | Trisodium ethylenediamine disuccinate Basic information |
| Product Name: | Trisodium ethylenediamine disuccinate | | Synonyms: | L-Aspartic acid, N,N-1,2-ethanediylbis-;2-[2-(1,2-dicarboxyethylamino)ethylamino]butanedioic acid;N,N'-ethylenediamine disuccinic acid;1-Ethylenediaminedisuccinic acid;Aspartic acid, N,N'-ethylenedi- (7CI);Aspartic acid, N,N'-ethylenedi-, 1,1- (8CI);N,N'-1,2-ethanediylbis-1-Aspartic acid;n,n'-1,2-ethanediylbis-l-aspartic aci | | CAS: | 20846-91-7 | | MF: | C10H16N2O8 | | MW: | 292.24 | | EINECS: | 439-840-1 | | Product Categories: | | | Mol File: | 20846-91-7.mol |  |
| | Trisodium ethylenediamine disuccinate Chemical Properties |
| Melting point | 220-222℃ | | density | 1.534 | | vapor pressure | 0Pa at 25℃ | | Boiling point | 516.7±50.0 °C(Predicted) | | pKa | 1.74±0.23(Predicted) | | Water Solubility | 150mg/L at 20℃ | | Cosmetics Ingredients Functions | CHELATING | | InChI | InChI=1S/C10H16N2O8/c13-7(14)3-5(9(17)18)11-1-2-12-6(10(19)20)4-8(15)16/h5-6,11-12H,1-4H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/t5-,6-/m0/s1 | | InChIKey | VKZRWSNIWNFCIQ-WDSKDSINSA-N | | SMILES | C(N[C@@H](CC(O)=O)C(O)=O)CN[C@@H](CC(O)=O)C(O)=O | | LogP | -1.4 at 23℃ | | EPA Substance Registry System | L-Aspartic acid, N,N'-1,2-ethanediylbis- (20846-91-7) |
| | Trisodium ethylenediamine disuccinate Usage And Synthesis |
| Uses | (2S,2''S)-2,2''-(Ethane-1,2-diylbis(azanediyl))disuccinic Acid functions as a chelant used in improving hair health and in preventing free radical formations. It is also used in the making of anti-snoring compositions. A chelants that enhances metal translocation in plants. | | Uses | Chelating agent in detergents, electroless plating, rust removal, photography, and soil remediation. | | Flammability and Explosibility | Non flammable |
| | Trisodium ethylenediamine disuccinate Preparation Products And Raw materials |
|