- 4,4'-DIBROMOBENZIL
-
- $6.60
-
2019-12-31
- CAS: 35578-47-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 4,4'-Dibromobenzil Basic information |
| Product Name: | 4,4'-Dibromobenzil | | Synonyms: | bis(4-bromophenyl)ethanedione;4,4'-DIBROMOBENZIL, TECH., 90%;4,4'-Dibromobenzil,97%;4,4'-dibromodibenzoyl;bis(4-bromophenyl)-ethanedion;LABOTEST-BB LT00159986;1,2-Bis(4-bromophenyl)-1,2-ethanedione;1,2-Bis(4-bromophenyl)ethanedione | | CAS: | 35578-47-3 | | MF: | C14H8Br2O2 | | MW: | 368.02 | | EINECS: | 252-628-1 | | Product Categories: | C13 to C14;Carbonyl Compounds;Aromatic Ketones (substituted);Ketones | | Mol File: | 35578-47-3.mol |  |
| | 4,4'-Dibromobenzil Chemical Properties |
| Melting point | 224-226 °C(lit.) | | Boiling point | 457.2±30.0 °C(Predicted) | | density | 1.6983 (rough estimate) | | refractive index | 1.4947 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | Yellow | | Water Solubility | Sparingly soluble in water. | | Henry's Law Constant | 8.0×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C14H8Br2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H | | InChIKey | NYCBYBDDECLFPE-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(=O)C(C1=CC=C(Br)C=C1)=O | | CAS DataBase Reference | 35578-47-3(CAS DataBase Reference) | | EPA Substance Registry System | Ethanedione, bis(4-bromophenyl)- (35578-47-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,4'-Dibromobenzil Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 4,4′-Dibromobenzil was used in preparation of 5,5′-bis -(4-bromo-phenyl)-3-methyl-imidazolidine-2,4-dione, 5,5′- bis -(4-bromo-phenyl)-3-butyl-imidazolidine-2,4-dione, 5,5′-bis-(4-bromo-phenyl)-3-pentyl-imidazolidine-2,4-dione and 5,5′-bis -(4-chloro-phenyl)-3-ethyl imidazolidine-2,4-dione. It was also used in synthesis of novel quinoxaline-based sensitizers for dye-sensitized solar cells. | | Uses | 4,4-Dibromobenzil was used in preparation of 5,5-bis-(4-bromo-phenyl)-3-methyl-imidazolidine-2,4-dione, 5,5-bis-(4-bromo-phenyl)-3-butyl-imidazolidine-2,4-dione,5,5-bis-(4-bromo-phenyl)-3-pentyl-imidazolidine-2,4-dione and 5,5-bis-(4-chloro-phenyl)-3-ethyl imidazolidine-2,4-dione.It was also used in synthesis of novel quinoxaline-based sensitizers for dye-sensitized solar cells. |
| | 4,4'-Dibromobenzil Preparation Products And Raw materials |
|