|
|
| | 5'-O-Dimethoxytrityl-N-benzoyl-desoxycytidine Basic information |
| | 5'-O-Dimethoxytrityl-N-benzoyl-desoxycytidine Chemical Properties |
| Melting point | 119 °C | | Boiling point | 668.71°C (rough estimate) | | density | 1.2234 (rough estimate) | | refractive index | 58 ° (C=1, MeOH) | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 30 mg/ml | | pka | 8.67±0.20(Predicted) | | form | powder to crystaline | | color | White to Almost white | | Water Solubility | 100μg/L at 20℃ | | BRN | 601627 | | InChIKey | MYSNCIZBPUPZMQ-VOTWKOMSSA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC(=CC=1)OC)(C1C=CC(=CC=1)OC)OC[C@@H]1[C@H](C[C@H](N2C=CC(=NC2=O)NC(C2C=CC=CC=2)=O)O1)O | | LogP | 5.3 at 20℃ | | CAS DataBase Reference | 67219-55-0(CAS DataBase Reference) | | EPA Substance Registry System | Cytidine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy- (67219-55-0) |
| | 5'-O-Dimethoxytrityl-N-benzoyl-desoxycytidine Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | N4-Benzoyl-5′-O-(4,4′-dimethoxytrityl)-2′-deoxycytidine has been used as research tool for anti-viral and anti-cancer studies. | | Uses | 5''-O-(4,4''-Dimethoxytrityl)-N4-benzoyl-2''-deoxycytidine (CAS# 67219-55-0) is a cytidine nucleoside derivative, and has been used as a reactant with synthetic modified DNA and RNA, such as in the site-selective RNA activation by acridine-modified oligodeoxynucleotides in metal-ion catalyzed hydrolysis. | | General Description | The 3′-O-(2-cyanoethyl)-N,N-diisopropylphosphoramidite derivatives of N4-benzoyl-5′-O-(4,4′-dimethoxytrityl)-2′-deoxycytidine (DMT-dCBz) participates in Diels-Alder reaction between diene-modified oligonucleotides and maleimide-derivatized peptides. | | Flammability and Explosibility | Not classified |
| | 5'-O-Dimethoxytrityl-N-benzoyl-desoxycytidine Preparation Products And Raw materials |
|