4-METHOXY-1-NAPHTHOL manufacturers
- 4-METHOXY-1-NAPHTHOL
-
- $3.00 / 1KG
-
2020-02-05
- CAS:84-85-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 4-METHOXY-1-NAPHTHOL Basic information |
| | 4-METHOXY-1-NAPHTHOL Chemical Properties |
| Melting point | 126-129 °C (lit.) | | Boiling point | 265.17°C (rough estimate) | | density | 1.0844 (rough estimate) | | refractive index | 1.5250 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.24±0.40(Predicted) | | color | Pale Purple to Light Purple | | Water Solubility | Soluble in water. | | BRN | 1818465 | | InChI | InChI=1S/C11H10O2/c1-13-11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7,12H,1H3 | | InChIKey | BOTGCZBEERTTDQ-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C=CC=C2)=C(OC)C=C1 | | CAS DataBase Reference | 84-85-5(CAS DataBase Reference) | | EPA Substance Registry System | 1-Naphthalenol, 4-methoxy- (84-85-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29095000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-METHOXY-1-NAPHTHOL Usage And Synthesis |
| Chemical Properties | GREY TO BROWN-PURPLE CRYSTALLINE POWDER | | Uses | 4-Methoxy-1-naphthol was used in the synthesis of 3-(4-hydroxy-1-naphthoxy)lactic acid (4-HO-NLA). | | Uses | 4-Methoxynaphthalen-1-ol is a novel antibacterial compound targeting the WalK/WalR two-component signal transduction system of Gram (+) bacteria. walrycin A is a novel human PXR activator, that induces human PXR transcriptional activity. 4-Methoxynaphthalen-1-ol is a WalR inhibitors, a novel antibacterial compound specifically targeting essential WalR response regulator. | | Definition | ChEBI: 4-Methoxy-1-naphthol is a member of naphthols. |
| | 4-METHOXY-1-NAPHTHOL Preparation Products And Raw materials |
|