|
|
| | 2-[(Diphenylmethyl)thio]acetamide Chemical Properties |
| Melting point | 109-110 °C(Solv: methanol (67-56-1); water (7732-18-5)) | | Boiling point | 427.7±33.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 15.60±0.40(Predicted) | | Appearance | White to off-white Solid | | BRN | 2053712 | | InChI | InChI=1S/C15H15NOS/c16-14(17)11-18-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17) | | InChIKey | HCRQRIFRHGPWBH-UHFFFAOYSA-N | | SMILES | C(N)(=O)CSC(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 68524-30-1(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | HS Code | 2930902000 |
| | 2-[(Diphenylmethyl)thio]acetamide Usage And Synthesis |
| Appearance | 2-[(Diphenylmethyl)thio]acetamide is a white solid. | | Uses | 2-[(Diphenylmethyl)thio]acetamide is an analogue and precursor to Modafinil (M482500), an α-1-adrenergic agonist. Modafinil is a CNS stimulant; psychostimulant that displays neuroprotective and antiparkinsonian activity in a primate model of Parkinson's disease. | | Uses | Deoxy Modafinil is an analogue and precursor to Modafinil (M482500), an a-1-adrenergic agonist. Modafinil is a CNS stimulant |
| | 2-[(Diphenylmethyl)thio]acetamide Preparation Products And Raw materials |
|