|
|
| | Ethyl acetamidocyanoacetate Basic information |
| Product Name: | Ethyl acetamidocyanoacetate | | Synonyms: | Ethyl (acetylamino)(cyano)acetate;Ethyl acetaminocyanoacetate;N-ACETYL-2-CYANOGLYCINE ETHYL ESTER;ACETIC ACID, (ACETYLAMINO)CYANO-, ETHYL ESTER;ACETAMIDOCYANOACETIC ACID ETHYL ESTER;ETHYL ACETAMIDOCYANOACETATE;Ethylacetamidocyanoacetate,98%;Ethyl N-Acetyl-2-Cyanoglcine | | CAS: | 4977-62-2 | | MF: | C7H10N2O3 | | MW: | 170.17 | | EINECS: | 225-624-2 | | Product Categories: | Amino ACIDS SERIES | | Mol File: | 4977-62-2.mol |  |
| | Ethyl acetamidocyanoacetate Chemical Properties |
| Melting point | 125-130 °C(lit.) | | Boiling point | 347.5±27.0 °C(Predicted) | | density | 1.155±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 15.93±0.46(Predicted) | | form | powder | | color | white to off-white | | BRN | 879845 | | InChI | InChI=1S/C7H10N2O3/c1-3-12-7(11)6(4-8)9-5(2)10/h6H,3H2,1-2H3,(H,9,10) | | InChIKey | SLIRLABNGAZSHX-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(NC(C)=O)C#N | | CAS DataBase Reference | 4977-62-2(CAS DataBase Reference) | | NIST Chemistry Reference | Glycine, n-acetyl-2-cyano-, ethyl ester(4977-62-2) |
| | Ethyl acetamidocyanoacetate Usage And Synthesis |
| Chemical Properties | Solid. | | Uses | Synthesis of amino acids and related compounds. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Ethyl acetamidocyanoacetate Preparation Products And Raw materials |
|