| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Tetramethylammonium hexafluorophosphate manufacturers
|
| | Tetramethylammonium hexafluorophosphate Basic information |
| | Tetramethylammonium hexafluorophosphate Chemical Properties |
| Melting point | >300 °C(lit.) | | refractive index | 1.482-1.485 | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | Powder | | color | White | | Water Solubility | Soluble in water. | | Sensitive | Moisture Sensitive | | BRN | 3730394 | | Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. May decompose on exposure to water or moist air. | | InChI | 1S/C4H12N.F6P/c1-5(2,3)4;1-7(2,3,4,5)6/h1-4H3;/q+1;-1 | | InChIKey | ZFKULDQWLXAKIM-UHFFFAOYSA-N | | SMILES | C[N+](C)(C)C.F[P-](F)(F)(F)(F)F | | CAS DataBase Reference | 558-32-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | BS8000000 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetramethylammonium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | white powder | | Uses | It finds its application in the oxidation of cytochrome c in nonaqueous solvents. | | Purification Methods | The salt (0.63g) is recrystallised from boiling H2O (76mL), yielding pure (0.45) Me4N.PF6 after drying at 100o. It is a good supporting electrolyte. [Lange & Müller Chem Ber 63 1067 1930, Beilstein 4 III 110.] |
| | Tetramethylammonium hexafluorophosphate Preparation Products And Raw materials |
|