| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3-Benzoylpyridine manufacturers
- 3-Benzoylpyridine
-
- $1.10
-
2026-08-20
- CAS:5424-19-1
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- 3-Benzoylpyridine
-
- $6.60
-
2020-01-03
- CAS:5424-19-1
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg -1000kg
|
| | 3-Benzoylpyridine Basic information |
| | 3-Benzoylpyridine Chemical Properties |
| Melting point | 36-40 °C(lit.) | | Boiling point | 307 °C(lit.) | | density | 1.1261 (rough estimate) | | refractive index | 1.5880 (estimate) | | Fp | 302 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | pka | 3.23±0.10(Predicted) | | form | Crystalline Solid | | color | White to light yellow | | BRN | 120234 | | InChI | InChI=1S/C12H9NO/c14-12(10-5-2-1-3-6-10)11-7-4-8-13-9-11/h1-9H | | InChIKey | RYMBAPVTUHZCNF-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(C1=CC=CN=C1)=O | | LogP | 1.880 | | CAS DataBase Reference | 5424-19-1(CAS DataBase Reference) | | NIST Chemistry Reference | Phenyl 3-pyridyl ketone(5424-19-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | OB6401000 | | HS Code | 2933 39 99 | | Storage Class | 11 - Combustible Solids |
| | 3-Benzoylpyridine Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT YELLOW CRYSTALLINE SOLID | | Uses | 3-Benzoylpyridine is a monopyridyl ketone ligand that binds cobalt(II) and nickel(II) through its nitrogen atom, giving complexes of the MX2L4, MX2L2 and MX2L4 types, and it also forms the polymeric mixed-ligand complex Cu(3-benzoylpyridine)2(N3)2 with copper(II) azide[1-2]. | | References |
[1]
Cabral, M., de O. Cabral, J. (1977). Complexes with pyridine derivatives—V. Journal of Inorganic and Nuclear Chemistry, 39(6), 985–989. https://doi.org/10.1016/0022-1902(77)80248-0
[2] Goher, M. A. S., Mautner, F. A. (1998). Synthesis, structural and spectral characterization of two polymeric complexes of 2-chloropyridine and 3-benzoylpyridine with copper(II) azide; [Cu(2-chloropyridine(N3)2]n and [Cu(3-benzoylpyridine)2(N3)2]n. Polyhedron, 17 9, Pages 1561-1570. https://doi.org/10.1016/S0277-5387(97)00364-1
|
| | 3-Benzoylpyridine Preparation Products And Raw materials |
|