DMT-2′Fluoro-dU Phosphoramidite manufacturers
- 2'-F-dU CE Phosphoramidite
-
- $100.00 / 15kg
-
2023-03-22
- CAS:146954-75-8
- Min. Order: 0.009999999776482582kg
- Purity: 99%
- Supply Ability: 5tons
|
| | DMT-2′Fluoro-dU Phosphoramidite Basic information |
| Product Name: | DMT-2′Fluoro-dU Phosphoramidite | | Synonyms: | 2'-Fluoro-5'-O-DMT-2'-deoxyuridine-3'-CE-Phosphoramidite;5'-DMT-2'-F-rU Phosphoramidite;DMT-2'-F-DU AMIDITE 0.25G, AB, SINGLE;DMT-2'-F-dU Amidite 0.25g, 89, Single;2’-F-rUPhosphoramidite;5'-O-(4,4-Dimethoxytrityl)-2'-deoxy-2'-fluorouridine-3'-(2-cyanoethyl-N,N-diisopropyl)phosphoramidite;5'-O-DMT-2'-F-dU-3'-CEDPA;2'-F-dU Phosphoramidite | | CAS: | 146954-75-8 | | MF: | C39H46FN4O8P | | MW: | 748.78 | | EINECS: | 2017-001-1 | | Product Categories: | Amidite | | Mol File: | 146954-75-8.mol |  |
| | DMT-2′Fluoro-dU Phosphoramidite Chemical Properties |
| storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | powder | | pka | 9.39±0.10(Predicted) | | color | white to off-white | | InChIKey | HQHQPAYRJJMYQX-YOKGOYKLNA-N | | SMILES | N1(C=CC(=O)NC1=O)[C@@H]1O[C@H](COC(C2=CC=CC=C2)(C2C=CC(=CC=2)OC)C2=CC=C(C=C2)OC)[C@@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@H]1F |&1:8,10,36,51,r| |
| | DMT-2′Fluoro-dU Phosphoramidite Usage And Synthesis |
| Uses | 5'-O-DMT-2'-F-Deoxyuridine-CE Phosphoramidite (DMT-2′Fluoro-dU Phosphoramidite) is a uridine phosphoramidite consisting of a fluorine in the 2' position, and the compound is used in the synthesis of DNA. | | Definition | DMT-2′Fluoro-dU Phosphoramidite is also known as 2'-F-U CE-Phosphoramidite. 2'-F-RNA oligonucleotides adopt an A-form helix on hybridisation to a target. Whereas a hydroxyl group of RNA is a hydrogen bond donor, fluorine appears to be a weak acceptor. These features of 2'-F-RNA oligonucleotides lead to certain interesting properties. For example, it was demonstrated that oligonucleotides hybridise to a RNA oligonucleotide in the following order of increasing stability: DNA < RNA < 2'-OMe-RNA < 2'-F-RNA |
| | DMT-2′Fluoro-dU Phosphoramidite Preparation Products And Raw materials |
|