- Dibutyl Phthalate
-
- $10.00 / 25kg
-
2025-11-14
- CAS:13831-31-7
- Min. Order: 1kg
- Purity: 99.5%
- Supply Ability: 100 TON
- Acetoxyacetyl chloride
-
- $0.00 / 1KG
-
2025-04-27
- CAS:13831-31-7
- Min. Order: 1KG
- Purity: 99% HPLC
- Supply Ability: 1KG 100KG 1MT
|
| | Acetoxyacetyl chloride Basic information |
| | Acetoxyacetyl chloride Chemical Properties |
| Melting point | 159-160 °C | | Boiling point | 55 °C/12 mmHg (lit.) | | density | 1.27 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.428(lit.) | | Fp | 160 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | Specific Gravity | 1.270 | | color | Clear colorless to pale yellow | | Water Solubility | Reacts with water violently. | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C4H5ClO3/c1-3(6)8-2-4(5)7/h2H2,1H3 | | InChIKey | HZDNNJABYXNPPV-UHFFFAOYSA-N | | SMILES | C(Cl)(COC(C)=O)=O | | CAS DataBase Reference | 13831-31-7(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34-36/37 | | Safety Statements | 23-26-27-36/37/39-45-8 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | TSCA | N | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29183000 |
| | Acetoxyacetyl chloride Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid | | Uses | Acetoxyacetyl chloride was used in synthesis of stabilized axial and equatorial conformers of spiro-β-lactams?and glycolylhydroxamic acids. |
| | Acetoxyacetyl chloride Preparation Products And Raw materials |
|