| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | trans-Methyl crotonate Basic information | | Synthesis |
| | trans-Methyl crotonate Chemical Properties |
| Melting point | -42°C | | Boiling point | 118-120 °C (lit.) | | density | 0.944 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.423(lit.) | | Fp | 40 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear colorless | | Odor | at 1.00 % in dipropylene glycol. sharp green fruity | | Odor Type | green | | Water Solubility | IMMISCIBLE | | Merck | 14,2597 | | BRN | 1720292 | | InChI | InChI=1S/C5H8O2/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3+ | | InChIKey | MCVVUJPXSBQTRZ-ONEGZZNKSA-N | | SMILES | C(OC)(=O)/C=C/C | | LogP | 1.316 (est) | | CAS DataBase Reference | 623-43-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Butenoic acid, methyl ester, (E)-(623-43-8) | | EPA Substance Registry System | Methyl trans-crotonate (623-43-8) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36-9-33 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 2 | | RTECS | GQ5710000 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29161980 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 |
| | trans-Methyl crotonate Usage And Synthesis |
| Synthesis | Trans-Methyl crotonate is obtained by esterification of crotonic acid and methanol. The reaction solution prepared by 800g of crotonic acid, 1L of methanol, 130g of sulfuric acid and 300ml of carbon tetrachloride was heated on a water bath, and carbon tetrachloride was recovered after dehydration and esterification to obtain a crude product of methyl crotonate. Then, the unreacted crotonic acid in the crude product is washed with water, washed with 5% sodium carbonate, and purified by vacuum distillation to obtain the finished product. | | Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | Methyl crotonate was used to investigate chemo selectivity in the reaction between methyl crotonate and benzyl amine catalyzed by lipase B from Candida Antarctica using solvent engineering. It was used as starting reagent during the total synthesis of phytotoxins solanapyrones D(1) and E(2). | | Synthesis Reference(s) | Tetrahedron Letters, 14, p. 2967, 1973 DOI: 10.1016/S0040-4039(01)96294-X | | General Description | Methyl crotonate undergoes vinylogous aldol reaction with enolizable aldehydes in the presence of aluminum tris(2,6-di-2-naphthylphenoxide). |
| | trans-Methyl crotonate Preparation Products And Raw materials |
|