| Identification | Back Directory | [Name]
TRIS(ACETYLACETONATO)YTTRIUM N-HYDRATE | [CAS]
207801-29-4 | [Synonyms]
CID 146157982 y(acac)3 hydrate Tris(acetylacetonato)yttrium xhydrate Yttrium(III) 2,4-pentanedionate, 99.9% TRIS(ACETYLACETONATO)YTTRIUM N-HYDRATE Yttrium(III) acetylacetonate hydrate, 99.95% TRIS(ACETYLACETONATO)YTTRIUM N-HYDRATE, 99.9% Yttrium(III) 2,4-pentanedionate hydrate, 99.9% (REO) Yttrium(III)acetyl acetonate hydrate{99.95%tracemetalsbasis} Yttrium(III) acetylacetonate hydrate, 99.9% trace rare earth metals basis (Z)-4-hydroxypent-3-en-2-one,(E)-4-hydroxypent-3-en-2-one,yttrium,hydrate Yttrium (III)acetylacetonate hydrate (Yttrium(III) 2,4-pentanedionate hydrate) Yttrium (III)acetylacetonate hydrate 99,9% (Yttrium(III) 2,4-pentanedionate hydrate) YTTRIUM ACETYLACETONATEYTTRIUM ACETYLACETONATEYTTRIUM ACETYLACETONATEYTTRIUM ACETYLACETONATE | [EINECS(EC#)]
689-573-1 | [Molecular Formula]
C15H23O7Y | [MDL Number]
MFCD03427495 | [MOL File]
207801-29-4.mol | [Molecular Weight]
404.24 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
crystal | [color ]
white to yellow | [Water Solubility ]
Insoluble in water. | [InChI]
1S/3C5H8O2.H2O.Y/c3*1-4(6)3-5(2)7;;/h3*3,6H,1-2H3;1H2;/q;;;;+3/p-3/b3*4-3-;; | [InChIKey]
KGNBFQNJCULYHV-KJVLTGTBSA-K | [SMILES]
O.CC(=O)\C=C(\C)O[Y](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| Hazard Information | Back Directory | [Uses]
Yttrium(III) 2,4-pentanedionate hydrate acts as a precursor with europium nitrate and used for the preparation of eurobium-doped yttrium orthovanadate nanoparticles. | [General Description]
Atomic number of base material: 39 Yttrium | [reaction suitability]
core: yttrium reagent type: catalyst |
|
| Company Name: |
INTATRADE GmbH
|
| Tel: |
+49 3493/605464 |
| Website: |
www.intatrade.de |
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|