- Propranolol
-
- $0.00 / 1kg
-
2026-01-16
- CAS:525-66-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20tons
- Propanolol
-
- $1.00 / 1kg
-
2026-01-05
- CAS:525-66-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
- propranolol
-
- $15.00/ kg
-
2024-04-24
- CAS:525-66-6
- Min. Order: 1kg
- Purity: 99.912%
- Supply Ability: 10ton
|
| | Propanolol Basic information |
| Product Name: | Propanolol | | Synonyms: | 1-isopropylamino-3-(1-naphthyloxy)propan-2-ol;Propanolol;1-[Isopropylamino]-3-[1-naphthyloxy]-2-propanol;2-Propanol, 1-(1-methylethyl)amino-3-(1-naphthalenyloxy)-;1-(1-Naphthyloxy)-3-(isopropylamino)-2-propanol;2-Propanol, 1-(isopropylamino)-3-(1-naphthyloxy)- (7CI, 8CI);2-Propanol, 1-[(1-methylethyl)amino]-3-(1-naphthalenyloxy)- (9CI);Betalong | | CAS: | 525-66-6 | | MF: | C16H21NO2 | | MW: | 259.34 | | EINECS: | 208-378-0 | | Product Categories: | | | Mol File: | 525-66-6.mol |  |
| | Propanolol Chemical Properties |
| Melting point | 163-164 °C | | Boiling point | 402.6°C (rough estimate) | | density | 1.0280 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 13.84±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | 80.99mg/L(25 ºC) | | InChI | InChI=1S/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3 | | InChIKey | AQHHHDLHHXJYJD-UHFFFAOYSA-N | | SMILES | C(NC(C)C)C(O)COC1=C2C(C=CC=C2)=CC=C1 | | CAS DataBase Reference | 525-66-6 | | NIST Chemistry Reference | Propranolol(525-66-6) | | EPA Substance Registry System | 2-Propanol, 1-[(1-methylethyl)amino]-3-(1-naphthalenyloxy)- (525-66-6) |
| | Propanolol Usage And Synthesis |
| Description | Propranolol was responsible for sensitisation of workers
in drug synthesis. In one case, epichlorhydrin was
used for the production of both propranolol and
oxprenolol. | | Chemical Properties | Colorless crystals.Soluble in
water and alcohol; insoluble in benzene and ether. | | Uses | Cardiac depressant (anti-arrhythmic); anti-adrenergic
(β-receptor). | | Uses | β?Adrenergic blocker. Antihypertensive; antianginal; antiarrhythmic (class II). | | Definition | ChEBI: A propanolamine that is propan-2-ol substituted by a propan-2-ylamino group at position 1 and a naphthalen-1-yloxy group at position 3. | | Indications | Major indications of propranolol, and of
many other β-blockers, include coronary heart
disease, hypertension, and cardiac arrhythmias.
These β-blocking agents are mainly used in
arrhythmias accompanied by increased catecholamine
levels, e.g., excitement, stress, or hyperthyroidism
. | | Brand name | Inderal (Wyeth); Innopran (Reliant). | | Hazard | Highly toxic. | | Contact allergens | Propranolol is a beta-blocking agent that was responsible
for the sensitization of workers in drug synthesis.
In one case, epichlorhydrin was used for the production
of drugs propranolol and oxprenolol. Crossreactivity
is expected between beta-blockers. |
| | Propanolol Preparation Products And Raw materials |
|