|
|
| | 2-Amino-4-chlorobenzoic acid Basic information |
| | 2-Amino-4-chlorobenzoic acid Chemical Properties |
| Melting point | 231-233 °C (lit.) | | Boiling point | 250°C (rough estimate) | | density | 1.3246 (rough estimate) | | refractive index | 1.5560 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | almost transparency in 1mol/L NaOH | | form | Powder | | pka | 4.71±0.10(Predicted) | | color | Beige to light brown | | Water Solubility | slightly soluble | | BRN | 743349 | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H6ClNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11) | | InChIKey | JYYLQSCZISREGY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Cl)C=C1N | | CAS DataBase Reference | 89-77-0(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Amino-4-chlorobenzoic acid(89-77-0) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | DG1570000 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Amino-4-chlorobenzoic acid Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | 2-Amino-4-chlorobenzoic Acid is used in the preparation of quinazolinone derivatives observed to be useful in the treatment of Alzheimer’s disease. Also it aids in the synthesis of non-nucleoside, thumb pocket 2 HCV NS5B polymerase inhibitors used in Hepatitis C therapy. | | Uses | 2-Amino-4-chlorobenzoic acid serves as the ligand L in the solvothermal synthesis of the terbium complex [Tb(L)2(H2O)3·H2O], which exhibits bright yellow-green luminescence[1]. 2-Amino-4-chlorobenzoic acid (2-A-4-CBA), acting as the first ligand, combines with 1,10-phenanthroline, the second ligand, to form the neodymium ternary complex Eu(2-A-4-CBA)₃phen. The compound is dissolved in ethanol to serve as a reference standard in thin layer chromatography (TLC) for detecting unreacted ligands in synthesized complexes[2]. | | Definition | ChEBI: 2-Amino-4-chlorobenzoic acid is an aminobenzoic acid. | | reaction suitability | reaction type: solution phase peptide synthesis | | References | [1]
CHEN, Y., XING, Z., CAO, S., WANG, Y. (2016). Synthesis and luminescent properties of terbium complex with 2-amino-4-chlorobenzoic acid. Journal of Rare Earths, 34(3), 240–244. https://doi.org/10.1016/s1002-0721(16)60020-0
[2]
Chen, Y., Wu, S., Xing, Z., Cao, S., Geng, X., Yang, Y., Xiao, L. (2015). Synthesis, structural characterization and luminescent properties of a novel europium ternary complex Eu(2-A-4-CBA)3phen. Journal of Alloys and Compounds, 649, 699–703. https://doi.org/10.1016/j.jallcom.2015.03.137 |
| | 2-Amino-4-chlorobenzoic acid Preparation Products And Raw materials |
| Preparation Products | 3',4'-Dichloroacetophenone-->1-Acetyl-5-broMo-6-chloro-1H-indol-3-yl acetate-->USP7-IN-1-->N-(3-chloro-4-fluorophenyl)-7-Methoxy-6-aminoquinazolin-4-aMine-->4,7-Dichloroquinazoline-->7-Chloro-4-quinazolinol-->6-Amino-11-chloronaphth[2,3-c]acridine-5,8,14(13H)-trione-->7-Chloro-3-hydroxybenzo[d][1,2,3]triazin-4(3H)-one-->7-chloro-3-(2-methylphenyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one-->2-Chloro-9,10-dihydro-9,10-[1,2]benzenoanthracene-->5-Bromo-4-chloro-2-iodo-benzoic acid-->7-Chloro-2-(trifluoromethyl)quinazolin-4(1H)-one-->3-Amino-7-chloro-2-methylquinazolin-4(3H)-one-->7-Chloro-2-chloroMethyl-1H-quinazolin-4-one |
|