|
|
| | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine Basic information |
| | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine Chemical Properties |
| Melting point | 133-1350C | | Boiling point | 537.3±60.0 °C(Predicted) | | density | 1.266±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.77±0.10(Predicted) | | color | Yellow to Dark Yellow | | InChI | InChI=1S/C16H15N5/c1-11-4-5-13(17)9-15(11)21-16-19-8-6-14(20-16)12-3-2-7-18-10-12/h2-10H,17H2,1H3,(H,19,20,21) | | InChIKey | QGAIPGVQJVGBIA-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C)C(NC2=NC=CC(C3=CC=CN=C3)=N2)=C1 | | LogP | 1.68 | | CAS DataBase Reference | 152460-10-1(CAS DataBase Reference) |
| | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine (Imatinib EP Impurity F) is a selective inhibitor of protein kinase C (PKC). It is a COVID19-related research product. | | Uses | Abacavir intermediate |
| | N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine Preparation Products And Raw materials |
|