|
|
| | 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene Basic information |
| Product Name: | 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene | | Synonyms: | 1-(4-chlorophenoxy)-2-nitrobenzene;p-chlorophenyl-o-nitrophenylether;1-[(4-Chlorophenyl)oxy]-2-nitrobenzene;4'-Chloro-2-nitrodiphenyl ether;2-Nitro-4`chloro–diphenylethe;1-Nitro-2-(4-chlorophenoxy)benzene;2-(4-Chlorophenoxy)-1-nitrobenzene;2-Nitrophenyl 4-chlorophenyl ether | | CAS: | 39145-47-6 | | MF: | C12H8ClNO3 | | MW: | 249.65 | | EINECS: | 254-316-0 | | Product Categories: | | | Mol File: | 39145-47-6.mol | ![1-[(4-Chlorophenyl)oxy]-2-nitrobenzene Structure](CAS/GIF/39145-47-6.gif) |
| | 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C12H8ClNO3/c13-9-5-7-10(8-6-9)17-12-4-2-1-3-11(12)14(15)16/h1-8H | | InChIKey | KVYVAGCVKWBOBS-UHFFFAOYSA-N | | SMILES | C1(OC2=CC=C(Cl)C=C2)=CC=CC=C1[N+]([O-])=O |
| RIDADR | UN3077 | | HazardClass | 9 |
| | 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 1-(4-Chlorophenoxy)-2-nitrobenzene is used as a reagent in the synthesis of novel benzamide derivatives containing a diphenyl ether moiety which display good antifungal and insecticidal properties. 1-(4-chlorophenoxy)-2-nitrobenzene also displays fungicidal activity against certain phytopathogenic fungi. |
| | 1-[(4-Chlorophenyl)oxy]-2-nitrobenzene Preparation Products And Raw materials |
|