|
|
| | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Basic information |
| Product Name: | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate | | Synonyms: | Diethyl3,5-di-tert-buty-4-hydroxy-ben-zylphosphonate;Irganox1222;Phosphonicacid,[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-,diethylester;[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-phosphonicacidiethyl;3,5-DI-TERT-BUTYL-4-HYDROXYBENZYLPHOSPHONIC ACID DIETHYL ESTER;diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate;diethyl [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]phosphonate;Diethyl-((3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)methyl)phosphonat | | CAS: | 976-56-7 | | MF: | C19H33O4P | | MW: | 356.44 | | EINECS: | 213-551-9 | | Product Categories: | | | Mol File: | 976-56-7.mol |  |
| | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Chemical Properties |
| Melting point | 122 °C | | Boiling point | 417.0±33.0 °C(Predicted) | | density | 1.046±0.06 g/cm3(Predicted) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 12.04±0.40(Predicted) | | color | White to Almost white | | Water Solubility | 14mg/L at 20℃ | | InChI | InChI=1S/C19H33O4P/c1-9-22-24(21,23-10-2)13-14-11-15(18(3,4)5)17(20)16(12-14)19(6,7)8/h11-12,20H,9-10,13H2,1-8H3 | | InChIKey | GJDRKHHGPHLVNI-UHFFFAOYSA-N | | SMILES | P(CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)(=O)(OCC)OCC | | LogP | 2.9 at 23℃ | | CAS DataBase Reference | 976-56-7(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonic acid, [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]-, diethyl ester (976-56-7) |
| Hazard Codes | Xi | | TSCA | TSCA listed | | HS Code | 2920.90.2000 |
| | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate Preparation Products And Raw materials |
|