| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromophenyl methyl sulfone Basic information |
| | 4-Bromophenyl methyl sulfone Chemical Properties |
| Melting point | 103-107 °C (lit.) | | Boiling point | 348.6±34.0 °C(Predicted) | | density | 1.595±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | form | Crystals or Crystalline Powder | | color | White | | BRN | 2045675 | | InChI | InChI=1S/C7H7BrO2S/c1-11(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 | | InChIKey | FJLFSYRGFJDJMQ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(S(C)(=O)=O)C=C1 | | CAS DataBase Reference | 3466-32-8(CAS DataBase Reference) |
| | 4-Bromophenyl methyl sulfone Usage And Synthesis |
| Chemical Properties | Whitetolightyellowcrystalspowe | | Uses | 4-Bromophenyl methyl sulfone may be used to synthesize:
- biaryl methyl sulfones
- 5-[[-4-(methylsulfonyl)phenyl]thio]thiophene-2-sulfonamide
- 1-[4-(methylsulfonyl)phenyl]-1H-pyrazole (Hmsppz)
- DuP 697 via reaction with (5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)trimethylsilane
4-Bromophenyl methyl sulfone (1-bromo-4-(methylsulfonyl)benzene) can undergo coupling reaction with benzene sulfonamide in the presence of copper(I)iodide to form the corresponding N-aryl sulfonamide. |
| | 4-Bromophenyl methyl sulfone Preparation Products And Raw materials |
|