| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 2-(Trimethylsilylmethyl)allyl acetate Basic information |
| Product Name: | 2-(Trimethylsilylmethyl)allyl acetate | | Synonyms: | 2-(Acetoxymethyl)allyltrimethyliane;2-(Acetoxymethyl)allyltrimethyliane;2-Acetoxymethyl-3-(trimethylsilyl)propene;2-(Trimethylsilylmethyl)allyl acetate;2-(Trimethylsilylmethyl)-2-propen-1-yl acetate;2-(ACETOXYMETHYL)-3-(TRIMETHYLSILYL)PROPENE;[2-(ACETOXYMETHYL)ALLYL]TRIMETHYLSILANE;2-(ACETOXYMETHYL)ALLYTRIMETHYLSILANE;2-[(TRIMETHYLSILYL)METHYL]-2-PROPEN-1-VL ACETATE;2-(TRIMETHYLSILYLMETHYL)ALLYL ACETATE;3-ACETOXY-2-(TRIMETHYLSILYLMETHYL)-1-PROPENE | | CAS: | 72047-94-0 | | MF: | C9H18O2Si | | MW: | 186.32 | | EINECS: | | | Product Categories: | | | Mol File: | 72047-94-0.mol |  |
| | 2-(Trimethylsilylmethyl)allyl acetate Chemical Properties |
| Boiling point | 95 °C7 mm Hg(lit.) | | density | 0.877 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.440(lit.) | | Fp | 160 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Solubility most organic solvents. | | form | Liquid | | color | Clear colorless | | Water Solubility | reacts | | BRN | 1933657 | | InChI | InChI=1S/C9H18O2Si/c1-8(6-11-9(2)10)7-12(3,4)5/h1,6-7H2,2-5H3 | | InChIKey | IKQWABMHZKGCLX-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)C(C[Si](C)(C)C)=C |
| | 2-(Trimethylsilylmethyl)allyl acetate Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Physical properties | bp 68–70°C/6.5 mmHg;60–61°C/2.5 mmHg. | | Uses | precursor for palladium trimethylenemethane cycloaddition reactions. | | Uses | 2-[(Acetoxymethyl)allyl]trimethylsilane was used in the cyclopentane synthesis via Pd(0)-catalyzed reactions with 2π acceptors. | | Preparation | commercially available but expensive. Several preparations of (1) or the precursor alcohol (2) have been reported. The simplest involves the direct silylation of methallyl alcohol (eq 1).
 |
| | 2-(Trimethylsilylmethyl)allyl acetate Preparation Products And Raw materials |
|