|
|
| | Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate Basic information |
| | Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate Chemical Properties |
| Melting point | 195-197 °C(lit.) | | Boiling point | 426.8±37.0 °C(Predicted) | | density | 1.4565 (rough estimate) | | refractive index | 1.6630 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.53±0.70(Predicted) | | form | Solid | | color | Off-White to Light Tan | | InChI | InChI=1S/C7H9N3O3S/c1-2-13-6(11)5(10-12)4-3-14-7(8)9-4/h3,12H,2H2,1H3,(H2,8,9)/b10-5- | | InChIKey | BTEPYCPXBCCSDL-YHYXMXQVSA-N | | SMILES | C(=N/O)(/C(=O)OCC)\C1=CSC(N)=N1 | | CAS DataBase Reference | 64485-82-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate Usage And Synthesis |
| Chemical Properties | light yellow to beige fine powder | | Uses | Ethyl 2-amino-α-(hydroxyimino)-4-thiazoleacetate may be used in chemical synthesis. | | Toxics Screening Level | The initial threshold screening level {ITSL) for thiazole ester is 17 μg/m3 based on an annual averaging time. |
| | Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate Preparation Products And Raw materials |
|