|
|
| | Tris(2-chloropropyl) phosphate Basic information |
| Product Name: | Tris(2-chloropropyl) phosphate | | Synonyms: | fyrol PCF;TRIS(2-CHLORO-1-PROPYL)PHOSPHATE;1-Propanol, 2-chloro-, phosphate (3:1);Phosphoric acid tris(2-chloropropyl) ester;TMCPP;Tris(2-chloropropyl) phosphate;1-Propanol, 2-chloro-, 1,1',1''-phosphate;tris(2-Chloropropyl)phosphate @50 μg/mL in Toluene | | CAS: | 6145-73-9 | | MF: | C9H18Cl3O4P | | MW: | 327.56 | | EINECS: | 228-150-4 | | Product Categories: | Organics | | Mol File: | 6145-73-9.mol |  |
| | Tris(2-chloropropyl) phosphate Chemical Properties |
| Boiling point | 358.5±22.0 °C(Predicted) | | density | 1.294 g/cm3 | | Henry's Law Constant | 1.6×102 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C9H18Cl3O4P/c1-7(10)4-14-17(13,15-5-8(2)11)16-6-9(3)12/h7-9H,4-6H2,1-3H3 | | InChIKey | GTRSAMFYSUBAGN-UHFFFAOYSA-N | | SMILES | P(=O)(OCC(Cl)C)(OCC(Cl)C)OCC(Cl)C | | EPA Substance Registry System | 1-Propanol, 2-chloro-, phosphate (3:1) (6145-73-9) |
| | Tris(2-chloropropyl) phosphate Usage And Synthesis |
| Uses | Tris(2-chloropropyl) Phosphate, is a human urinary organophosphate flame retardant metabolite. |
| | Tris(2-chloropropyl) phosphate Preparation Products And Raw materials |
|