|
|
| | 1-Adamantanemethylamine Basic information |
| | 1-Adamantanemethylamine Chemical Properties |
| Boiling point | 83-85 °C/0.3 mmHg (lit.) | | density | 0.933 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5137(lit.) | | Fp | 198 °F | | storage temp. | 2-8°C(protect from light) | | form | Liquid | | pka | 10.71±0.29(Predicted) | | color | Colorless to pale yellow | | Sensitive | Air Sensitive | | InChI | 1S/C11H19N/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7,12H2/t8-,9+,10-,11- | | InChIKey | XSOHXMFFSKTSIT-BIBSGERRSA-N | | SMILES | NCC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 | | CAS DataBase Reference | 17768-41-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Adamantanemethylamine(17768-41-1) |
| Hazard Codes | Xi,C | | Risk Statements | 34 | | Safety Statements | 24/25-45-36/37/39-27-26 | | RIDADR | UN 2735 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HazardClass | 8 | | HS Code | 29213000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 1-Adamantanemethylamine Usage And Synthesis |
| Chemical Properties | clear colourless to very slightly yellow liquid | | Uses | Adamantan-1-ylmethanamine (1-Aminomethyladamantane) is a Hyt hydrophobic group. Adamantan-1-ylmethanamine can be used in the synthesis of ZX782 (HY-161972)[1]. | | General Description | 1-Adamantanemethylamine is a large amine present on the wall of 6,7-diaminoquinoxaline. The thermodynamic complex formation constant of 1-adamantanemethylamine was studied. | | Purification Methods | Dissolve the amine in Et2O, dry over KOH and distil it. The N-Tosyl derivative has m 134-135o (from EtOH). [Stetter & Goebel Chem Ber 96 550 1963.] | | References | [1] Li X, et al. Design, Synthesis, and Biological Evaluation of Hydrophobic-Tagged Glutathione Peroxidase 4 (GPX4) Degraders. Bioorg Chem. 2024 Mar;144:107115. DOI:10.1016/j.bioorg.2024.107115 |
| | 1-Adamantanemethylamine Preparation Products And Raw materials |
|