3-Nitrobenzylammonium hydrochloride manufacturers
|
| | 3-Nitrobenzylammonium hydrochloride Basic information |
| | 3-Nitrobenzylammonium hydrochloride Chemical Properties |
| Melting point | 229-231 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | color | Off-white to tan | | InChI | 1S/C7H8N2O2.ClH/c8-5-6-2-1-3-7(4-6)9(10)11;/h1-4H,5,8H2;1H | | InChIKey | DLZXLCHQWOZGSE-UHFFFAOYSA-N | | SMILES | Cl.NCc1cccc(c1)[N+]([O-])=O | | CAS DataBase Reference | 26177-43-5(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-33-23/24 | | Safety Statements | 26-36-24/25 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29420000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Nitrobenzylammonium hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 3-Nitrobenzylamine Hydrochloride is an intermediate in many organic syntheses. |
| | 3-Nitrobenzylammonium hydrochloride Preparation Products And Raw materials |
|