| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-(Hydroxymethyl)-benzoic acid Basic information |
| | 3-(Hydroxymethyl)-benzoic acid Chemical Properties |
| Melting point | 114.5-115 °C | | Boiling point | 358.1±25.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.20±0.10(Predicted) | | form | powder | | color | Off-white | | InChI | InChI=1S/C8H8O3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,9H,5H2,(H,10,11) | | InChIKey | UOKBFIOAEPCADP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(CO)=C1 |
| | 3-(Hydroxymethyl)-benzoic acid Usage And Synthesis |
| Uses | 3-(hydroxymethyl)benzoic acid is an intermediate for the synthesis of pesticides and flavors, and a good highlighter for color films. | | Synthesis | 3-(hydroxymethyl)benzoic acid can be prepared by acetic acid, catalys and initiator stirred with xylene and hydrogen peroxide at 115℃ for 1-5h. | | References | [1] Patent: WO2004/113281, 2004, A1. Location in patent: Page 49-50 |
| | 3-(Hydroxymethyl)-benzoic acid Preparation Products And Raw materials |
|