|
|
| | 3-Cyano-6-methyl-2(1H)-pyridinone Basic information |
| | 3-Cyano-6-methyl-2(1H)-pyridinone Chemical Properties |
| Melting point | 293-295 °C (lit.) | | Boiling point | 247.23°C (rough estimate) | | density | 1.2296 (rough estimate) | | refractive index | 1.5880 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.03±0.10(Predicted) | | form | Solid | | color | White to Pale Yellow | | Water Solubility | 2.38 g/L (20 ºC) | | BRN | 120412 | | InChI | InChI=1S/C7H6N2O/c1-5-2-3-6(4-8)7(10)9-5/h2-3H,1H3,(H,9,10) | | InChIKey | FIMGYEKEYXUTGD-UHFFFAOYSA-N | | SMILES | C1(=O)NC(C)=CC=C1C#N | | CAS DataBase Reference | 4241-27-4(CAS DataBase Reference) | | EPA Substance Registry System | 3-Pyridinecarbonitrile, 1,2-dihydro-6-methyl-2-oxo- (4241-27-4) |
| | 3-Cyano-6-methyl-2(1H)-pyridinone Usage And Synthesis |
| Chemical Properties | SLIGHTLY YELLOW GRANULAR CRYSTALLINE POWDER | | Uses | 3-Cyano-6-methyl-2(1H)-pyridinone is a reactant used in the synthesis of Milrinone (M344680), a selective phosphodiesterase inhibitor with vasodilating and positive inotropic activity. 3-It has also been used in the preparation of the N3?-pyridyl thiamine, a potent in vitro thiamine antagonist. | | General Description | Supramolecular structures of coordination copper(I) compounds of 3-cyano-6-methyl-2(1H)-pyridinone has been investigated. |
| | 3-Cyano-6-methyl-2(1H)-pyridinone Preparation Products And Raw materials |
|