- 4-Fluoro-3-methylphenol
-
- $30.00 / 1kg
-
2023-09-08
- CAS:452-70-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000t/year
- 4-Fluoro-3-methylphenol
-
- $2.00 / 1KG
-
2020-01-08
- CAS:452-70-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100g , 1kg, 5kg , 50kg
|
| | 4-Fluoro-3-methylphenol Basic information |
| | 4-Fluoro-3-methylphenol Chemical Properties |
| Melting point | 32 °C (lit.) | | Boiling point | 76 °C/5 mmHg (lit.) | | density | 1.134 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.515(lit.) | | Fp | 206 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Liquid | | pka | 10.09±0.18(Predicted) | | Specific Gravity | 1.134 | | color | Clear colorless to pale yellow | | InChI | InChI=1S/C7H7FO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 | | InChIKey | RVYGYYVGWSCWGY-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(F)C(C)=C1 | | CAS DataBase Reference | 452-70-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 1759 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 29081990 |
| | 4-Fluoro-3-methylphenol Usage And Synthesis |
| Chemical Properties | Yellow liquid | | Uses | 4-Fluoro-3-methylphenol was used to detect the aromatic metabolites in methanogenic m-cresol-degrading consortium. It was also used in the preparation of 8-fluoronaphthoquinone via Friedel Crafts acylation reaction with maleic anhydride. |
| | 4-Fluoro-3-methylphenol Preparation Products And Raw materials |
|