- 4-Aminophthalic acid
-
- $167.44 / 25Kg/Drum
-
2025-07-15
- CAS:5434-21-9
- Min. Order: 25Kg/Drum
- Purity: 98.50%HPLC
- Supply Ability: 6tons/month
- 4-Aminophthalic acid
-
- $0.00 / 25KG
-
2025-07-07
- CAS:5434-21-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
- 4-Aminophthalic acid
-
- $10.00 / 1KG
-
2025-06-24
- CAS:5434-21-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | 4-Aminophthalic acid Basic information |
| | 4-Aminophthalic acid Chemical Properties |
| Melting point | 344 °C (dec.)(lit.) | | Boiling point | 465.1±40.0 °C(Predicted) | | density | 1.551±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 3.41±0.10(Predicted) | | form | powder to crystal | | color | White to Gray to Brown | | BRN | 2723405 | | InChI | InChI=1S/C8H7NO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) | | InChIKey | OXSANYRLJHSQEP-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC=C(N)C=C1C(O)=O | | CAS DataBase Reference | 5434-21-9(CAS DataBase Reference) | | EPA Substance Registry System | 4-Aminophthalic acid (5434-21-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29224999 |
| | 4-Aminophthalic acid Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 4-Aminophthalic acid Preparation Products And Raw materials |
|