| Identification | More | [Name]
GLYCOLALDEHYDE DIMER | [CAS]
23147-58-2 | [Synonyms]
1,4-DIOXANE-2,5-DIOL 2,5-DIHYDROXY-1,4-DIOXANE 2,5-DIHYDROXY-P-DIOXANE GLYCOALDEHYDE DIMER GLYCOLALDEHYDE DIMER HYDROXYACETALDEHYDE DIMER glycolaldehyde dimer, mixture of stereoisomers GLYCOLALDEHYDE DIMER, CRYSTALLINE GLYCOLALDEHYDE DIMER extrapure 1,4-Dioxane-2,5-diol, 2,5-Dihydroxy-1,4-dioxane, Hydroxyacetaldehyde dimer | [EINECS(EC#)]
205-484-9 | [Molecular Formula]
C4H8O4 | [MDL Number]
MFCD00012133 | [Molecular Weight]
120.1 | [MOL File]
23147-58-2.mol |
| Chemical Properties | Back Directory | [Melting point ]
~85 °C | [Boiling point ]
312.4±42.0 °C(Predicted) | [density ]
1.455 | [storage temp. ]
2-8°C
| [solubility ]
H2O: 0.1 g/mL, clear, colorless
| [form ]
crystalline
| [pka]
11.97±0.40(Predicted) | [color ]
White to Off-White | [BRN ]
506029 | [InChI]
InChI=1S/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 | [InChIKey]
ATFVTAOSZBVGHC-UHFFFAOYSA-N | [SMILES]
O1CC(O)OCC1O | [CAS DataBase Reference]
23147-58-2(CAS DataBase Reference) |
| Hazard Information | Back Directory | [Uses]
Glycolaldehyde dimer may be used in the synthesis of 3,4-diaza-2-hexene-1,6-diol, which can undergo hydrogenation to form 1,2-bis(2-hydroxyethyl)hydrazine. It undergoes cycloaddition with 2,3-dihydrofuran in the presence of a chiral catalyst to form fused bicyclic tetrahydrofuran (bis-THF) alcohol, a key moiety of HIV protease inhibitors. | [Uses]
Glycoaldehyde Dimer is derivative of glcoaldehyde, which is the precursor molecule of various significant compounds including amino acid glycine and in the formose reaction. | [Definition]
ChEBI: Glycolaldehyde dimer is a member of dioxanes. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Telephone: |
0573-85285100 18627885956 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Telephone: |
021-021-021-67601398-809-809-809 15221380277 |
| Website: |
www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us |
| Company Name: |
Shanghai URChem Limited
|
| Telephone: |
+86-021-50890968,021-50891159 +86-18601776121 |
| Website: |
http://www.urchem.com |
|