- 2-Chloro-5-nitrobenzoic acid
-
- $35.10 / 25Kg/Drum
-
2026-04-30
- CAS:2516-96-3
- Min. Order: 25Kg/Drum
- Purity: 99.50%HPLC
- Supply Ability: 20tons/month
|
| | 2-Chloro-5-nitrobenzoic acid Basic information |
| | 2-Chloro-5-nitrobenzoic acid Chemical Properties |
| Melting point | 165-168 °C (lit.) | | Boiling point | 356.5±27.0 °C(Predicted) | | density | 1.6 | | refractive index | 1.6000 (estimate) | | Fp | >100°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | 3.6g/l | | pka | pK1: 2.17 (25°C) | | form | Crystalline Powder | | color | Light yellow to beige-brown | | BRN | 1877474 | | Henry's Law Constant | 6.5×103 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) | | InChI | 1S/C7H4ClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) | | InChIKey | QUEKGYQTRJVEQC-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(ccc1Cl)[N+]([O-])=O | | CAS DataBase Reference | 2516-96-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Chloro-5-nitrobenzoic acid(2516-96-3) | | EPA Substance Registry System | Benzoic acid, 2-chloro-5-nitro- (2516-96-3) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 22-37/38-41-50-36/37/38 | | Safety Statements | 26-39-61-24/25-36 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 1 | | TSCA | TSCA listed | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | 2-Chloro-5-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | light yellow to light yellow-green crystalline | | Uses | 2-Chloro-5-nitrobenzoic Acid is used in the synthesis of sesquiterpenoids as potential antibacterial compounds. Also used in the synthesis of substituted phenyl oxazoles as novel LSD1 inhibitors with antiproliferative activity. In addition it’s used to synthesize cathespin L inhibitors. | | General Description | 2-Chloro-5-nitrobenzoic acid undergoes microwave-assisted, regioselective amination reaction with aliphatic and aromatic amines to yield N-substituted 5-nitroanthranilic acid derivatives. It acts as ligand and forms a red luminescent one dimensional coordination polymer with Eu(III). |
| | 2-Chloro-5-nitrobenzoic acid Preparation Products And Raw materials |
|