|
|
| | (R)-Piperidine-2-carboxylic acid methyl ester hydrochloride Basic information |
| | (R)-Piperidine-2-carboxylic acid methyl ester hydrochloride Chemical Properties |
| Melting point | >158°C (dec.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | Consistent with structure | | Stability: | Hygroscopic | | InChI | InChI=1/C7H13NO2.ClH/c1-10-7(9)6-4-2-3-5-8-6;/h6,8H,2-5H2,1H3;1H/t6-;/s3 | | InChIKey | APCHKWZTSCBBJX-UZHXKHNSNA-N | | SMILES | [C@H]1(NCCCC1)C(=O)OC.Cl |&1:0,r| |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | (R)-Piperidine-2-carboxylic acid methyl ester hydrochloride Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | (R)-Piperidine-2-carboxylic Acid Methyl Ester Hydrochloride is used in preparation and application of aromatic compound having immunoregulatory function. |
| | (R)-Piperidine-2-carboxylic acid methyl ester hydrochloride Preparation Products And Raw materials |
|