| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 2-Mercapto-3-butanol
-
-
2026-06-30
- CAS:37887-04-0
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- 2-Mercapto-3-butanol
-
- $20.00
-
2025-06-20
- CAS:37887-04-0
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons per month
|
| | 2-Mercapto-3-butanol Basic information |
| | 2-Mercapto-3-butanol Chemical Properties |
| Boiling point | 53 °C/10 mmHg (lit.) | | density | 1.013 g/mL at 25 °C (lit.) | | FEMA | 3502 | 2-MERCAPTO-3-BUTANOL | | refractive index | n20/D 1.48(lit.) | | Fp | 143 °F | | pka | 10.57±0.10(Predicted) | | Specific Gravity | 0.999 | | Odor | at 0.10 % in propylene glycol. sulfury roasted onion garlic meaty | | Odor Type | sulfurous | | biological source | synthetic | | JECFA Number | 546 | | Major Application | flavors and fragrances | | InChI | InChI=1/C4H10OS/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4+/s3 | | InChIKey | MJQWABQELVFQJL-QZMQZWAZNA-N | | SMILES | C[C@@H](O)[C@@H](S)C |&1:1,3,r| | | LogP | 0.47 | | CAS DataBase Reference | 37887-04-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 3336 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 2-Mercapto-3-butanol Usage And Synthesis |
| Uses | 2-Mercapto-3-butanol is used in preparation of low-energy UV curing polyurethane acrylate prepolymer with fast UV curing speed, good toughness and stable storage and UV curing coating. | | Taste threshold values | Taste characteristics at 4 ppm: meaty, savory, sauteed onion and garlic. | | Biochem/physiol Actions | Taste at 4 ppm |
| | 2-Mercapto-3-butanol Preparation Products And Raw materials |
|