|
|
| | 2-Amino-6-methylbenzoic acid Basic information |
| | 2-Amino-6-methylbenzoic acid Chemical Properties |
| Melting point | 128-130 °C (dec.) (lit.) | | Boiling point | 273.17°C (rough estimate) | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in methanol. | | pka | 1.95±0.31(Predicted) | | form | powder to crystal | | color | White to Light yellow to Dark green | | BRN | 2803391 | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H9NO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11) | | InChIKey | XHYVBIXKORFHFM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(C)C=CC=C1N | | CAS DataBase Reference | 4389-50-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 10 | | Hazard Note | Irritant | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Amino-6-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | Beige to pink powder | | Uses | 2-Amino-6-methylbenzoic acid reacts with cyanogen bromide to prepare 2-amino-5-methyl-benzo[d][1,3]oxazin-4-one. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | General procedure for the synthesis of 2-amino-6-methylbenzoic acid from 2-methyl-6-nitrobenzoic acid: Pd/C catalyst (150 mg) was added to a methanol (35 mL) solution of 2-methyl-6-nitrobenzoic acid (1.5 g, 8.29 mmol). The reaction mixture was stirred for 2 hours at room temperature under hydrogen atmosphere. Upon completion of the reaction, the mixture was filtered to remove the catalyst and the filtrate was subsequently concentrated to give 2-amino-6-methylbenzoic acid (1.2 g) in yellow solid form. The product was characterized by liquid chromatography-mass spectrometry (LCMS, ESI mode): the calculated value of C8H9NO2 [M+H]+ was 152 and the measured value was 152, as expected. | | References | [1] Patent: US5753664, 1998, A
[2] Tetrahedron Letters, 1984, vol. 25, # 8, p. 839 - 842
[3] Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982, # 8, p. 1637 - 1648
[4] Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982, # 8, p. 1701 - 1714
[5] Journal fuer Praktische Chemie (Leipzig), 1985, vol. 327, # 5, p. 865 - 867 |
| | 2-Amino-6-methylbenzoic acid Preparation Products And Raw materials |
|