- Phenyltriethoxysilane
-
-
2026-10-16
- CAS:780-69-8
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | Phenyltriethoxysilane Basic information |
| | Phenyltriethoxysilane Chemical Properties |
| Melting point | <-50°C | | Boiling point | 112-113 °C10 mm Hg(lit.) | | density | 0.996 g/mL at 25 °C(lit.) | | vapor density | >1 (vs air) | | vapor pressure | 0-7910Pa at 20-25℃ | | refractive index | n20/D 1.461(lit.) | | Fp | 109 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | Specific Gravity | 0.996 | | color | Colorless to Almost colorless | | Odor | Mild odor | | Water Solubility | insoluble | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 2940602 | | InChI | 1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 | | InChIKey | JCVQKRGIASEUKR-UHFFFAOYSA-N | | SMILES | CCO[Si](OCC)(OCC)c1ccccc1 | | LogP | -0.31-3.4 at 22℃ | | CAS DataBase Reference | 780-69-8(CAS DataBase Reference) | | NIST Chemistry Reference | Triethoxyphenylsilane(780-69-8) | | EPA Substance Registry System | Silane, triethoxyphenyl- (780-69-8) |
| Hazard Codes | Xi,Xn | | Risk Statements | 10-21-36/37/38 | | Safety Statements | 37/39-26-16-24/25 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | RTECS | VV4900000 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29310095 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3
Flam. Liq. 3
STOT RE 2 Oral |
| | Phenyltriethoxysilane Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid | | Uses | Phenyltriethoxysilane, a silane coupling agent, is used in preparation of self-healing or reusable coatings. | | Flammability and Explosibility | Flammable |
| | Phenyltriethoxysilane Preparation Products And Raw materials |
|