Methyclothiazide manufacturers
- Methyclothiazide
-
- $1.00
-
2019-12-20
- CAS:135-07-9
- Min. Order: 1KG
- Purity: 95%~99%
- Supply Ability: 1ton
|
| | Methyclothiazide Basic information |
| Product Name: | Methyclothiazide | | Synonyms: | METHYCLOTHIAZIDE;2-methyl-,1,1-dioxide;4-benzothiadiazine-7-sulfonamide,6-chloro-3-(chloromethyl)-3,4-dihydro-2h-2;6-chloro-3-(chloromethyl)-3,4-dihydro-2-methyl-2h-1,2,4-benzothiadiazine-7-sul;6-chloro-3-chloromethyl-2-methyl-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazine;methychlothiazide;methyclothiazid;methycyclothiazide | | CAS: | 135-07-9 | | MF: | C9H11Cl2N3O4S2 | | MW: | 360.24 | | EINECS: | 205-172-2 | | Product Categories: | Inhibitors;TYLAN | | Mol File: | 135-07-9.mol |  |
| | Methyclothiazide Chemical Properties |
| Melting point | 225° | | Boiling point | 597.9±60.0 °C(Predicted) | | density | 1.6122 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.4(at 25℃) | | color | White to Off-White | | Water Solubility | 50mg/L(room temperature) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C9H11Cl2N3O4S2/c1-14-9(4-10)13-6-2-5(11)7(19(12,15)16)3-8(6)20(14,17)18/h2-3,9,13H,4H2,1H3,(H2,12,15,16) | | InChIKey | CESYKOGBSMNBPD-UHFFFAOYSA-N | | SMILES | [S]1(=O)(=O)N(C(Nc2c1cc(c(c2)Cl)[S](=O)(=O)N)CCl)C | | EPA Substance Registry System | 2H-1,2,4-Benzothiadiazine-7-sulfonamide, 6-chloro-3-(chloromethyl)-3,4-dihydro-2-methyl-, 1,1-dioxide (135-07-9) |
| | Methyclothiazide Usage And Synthesis |
| Uses | Methyclothiazid, is derivative of Hydrochlorothiazide (H714560), which is a diuretic used in the hospital or for personal use to promote excess fluid associated with congestive heart failure. It is also used as an antihypertensive. | | Uses | antibacterial | | Definition | ChEBI: Methyclothiazide is a benzothiadiazine. | | Brand name | Aquatensen (Medpointe);
Enduron (Abbott). |
| | Methyclothiazide Preparation Products And Raw materials |
|