- Fmoc-D-Ser(tBu)-OH
-
- $0.00/ kg
-
2026-04-27
- CAS:128107-47-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-D-Ser(tBu)-OH
-
- $0.00 / 25Kg/Drum
-
2026-04-27
- CAS:128107-47-1
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Fmoc-D-Ser(tBu)-OH
-
- $1350.00 / 1Kg
-
2024-11-12
- CAS:128107-47-1
- Min. Order: 0.100Kg
- Purity: 99 %
- Supply Ability: 500 Kg
|
| | Fmoc-O-tert-butyl-D-serine Basic information |
| | Fmoc-O-tert-butyl-D-serine Chemical Properties |
| Melting point | 131℃ | | Boiling point | 578.6±50.0 °C(Predicted) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.44±0.10(Predicted) | | color | White to off-white | | Optical Rotation | Consistent with structure | | BRN | 5309984 | | Major Application | peptide synthesis | | InChI | InChI=1S/C22H25NO5/c1-22(2,3)28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m1/s1 | | InChIKey | REITVGIIZHFVGU-LJQANCHMSA-N | | SMILES | C(O)(=O)[C@@H](COC(C)(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 128107-47-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-O-tert-butyl-D-serine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-D-Ser(tBu)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-O-tert-butyl-D-serine Preparation Products And Raw materials |
|