- 3-Benzyloxy-1,2-propanediol
-
- $50.00 / 1KG
-
2025-09-25
- CAS:4799-67-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-Benzyloxy-1,2-propanediol Basic information |
| | 3-Benzyloxy-1,2-propanediol Chemical Properties |
| Melting point | 62.7-63.4 °C | | Boiling point | 140-145°C | | density | 1.140 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.533 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.65±0.20(Predicted) | | color | Off-White | | BRN | 3199937 | | Stability: | Stable. Hygroscopic. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C10H14O3/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 | | InChIKey | LWCIBYRXSHRIAP-UHFFFAOYSA-N | | SMILES | C(O)C(O)COCC1=CC=CC=C1 |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | TY3180000 | | F | 3-9 | | HS Code | 2909498090 |
| | 3-Benzyloxy-1,2-propanediol Usage And Synthesis |
| Chemical Properties | White Semi Solid | | Uses | (±)-3-Benzyloxy-1,2-propanediol was used in capillary electrophoretic enantioseparation of vicinol diols using different β-cyclodextrin derivatives and borate. It was used in the synthesis and immobilization of 2,3-di-O-phytanyl-sn-glycerol-1-tetraethylene glycol-(3-trichloropropyl-silane) ether lipid (DPTTC) and 2,3-di-O-phytanyl-sn-glycerol-1-tetraethylene glycol-(3-chloro-dimethylpropyl-silane) ether lipid(DPTDC). | | General Description | (±)-3-Benzyloxy-1,2-propanediol undergoes enantioseparation by ligand exchange micellar electrokinetic chromatography using borate anion as a central ion. |
| | 3-Benzyloxy-1,2-propanediol Preparation Products And Raw materials |
|