|
|
| | N-(Benzyloxycarbonyloxy)succinimide Basic information |
| | N-(Benzyloxycarbonyloxy)succinimide Chemical Properties |
| Melting point | 80-82 °C(lit.) | | Boiling point | 392.32°C (rough estimate) | | density | 1.3189 (rough estimate) | | refractive index | 1.5560 (estimate) | | Fp | 81°C | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | acetone: 0.1 g/mL, clear | | form | Fine Crystalline Powder | | color | White to off-white | | Decomposition | 81 ºC | | Sensitive | Moisture Sensitive | | BRN | 1387927 | | Stability: | Stable. Moisture sensitive. | | InChI | InChI=1S/C12H11NO5/c14-10-6-7-11(15)13(10)18-12(16)17-8-9-4-2-1-3-5-9/h1-5H,6-8H2 | | InChIKey | MJSHDCCLFGOEIK-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)ON1C(=O)CCC1=O | | CAS DataBase Reference | 13139-17-8(CAS DataBase Reference) |
| | N-(Benzyloxycarbonyloxy)succinimide Usage And Synthesis |
| Chemical Properties | white crystal powde | | Uses | N-(Benzyloxycarbonyloxy)succinimide (Cbz-OSu) is a common reagent for the carboxybenzyl protection of amines. This reaction is one of the key synthetic steps in the synthesis of:
- Enantiomers of cyclic methionine analogs viz, (R)-and (S)-3-aminotetrahydrothiophene- 3-carboxylic acid.
- 1′-H-Spiro-(indoline-3,4′-piperidine) and its derivatives.
- Total synthesis of (-)-diazonamide A. and (-)-sanglifehrin A.
Cbz-OSu is widely employed to protect amino acid residues in peptide synthesis. It can also be used in N-trans diprotection of cyclen regioselectively. | | Uses | N-(N-Benzyloxycarbonyloxy)succinimide is a reagent used in the preparation of peptide thioacids view peptide precursors. Also used in the preparation of amino glycoside derivatives for the function of topoisomerase for both human and bacterial inhibition. | | Uses | Reagents for the selective introduction of the Z-protecting group into amino compounds |
| | N-(Benzyloxycarbonyloxy)succinimide Preparation Products And Raw materials |
|